C52H37N3O5 — CID 144568695
6-[10-[6-(9-phenyl-7,8-dihydrocarbazol-3-yl)-1,2-dihydrocarbazol-9-yl]benzo[c]carbazol-7-yl]benzene-1,2,3,4,5-pentol (PubChem CID 144568695) has the molecular formula C52H37N3O5 and a molecular weight of 783.88 g/mol. Its IUPAC name is 6-[10-[6-(9-phenyl-7,8-dihydrocarbazol-3-yl)-1,2-dihydrocarbazol-9-yl]benzo[c]carbazol-7-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-[6-(9-phenyl-7,8-dihydrocarbazol-3-yl)-1,2-dihydrocarbazol-9-yl]benzo[c]carbazol-7-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 144568695 |
| Molecular Formula | C52H37N3O5 |
| Molecular Weight | 783.88 g/mol |
| Exact Mass | 783.27 |
| IUPAC Name | 6-[10-[6-(9-phenyl-7,8-dihydrocarbazol-3-yl)-1,2-dihydrocarbazol-9-yl]benzo[c]carbazol-7-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-n2c3ccc(-n4c5c(c6cc(-c7ccc8c(c7)c7c(n8-c8ccccc8)CCC=C7)ccc64)C=CCC5)cc3c3c4ccccc4ccc32)c(O)c1O |
| InChI | InChI=1S/C52H37N3O5/c56-48-47(49(57)51(59)52(60)50(48)58)55-44-25-21-33(28-39(44)46-34-13-5-4-10-29(34)18-24-45(46)55)54-41-17-9-7-15-36(41)38-27-31(20-23-43(38)54)30-19-22-42-37(26-30)35-14-6-8-16-40(35)53(42)32-11-2-1-3-12-32/h1-7,10-15,18-28,56-60H,8-9,16-17H2 |
| InChIKey | IQIBBKKCFQEPSH-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.88 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|