About 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one
4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one (PubChem CID 14456877) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one.
Analyze 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one?
The IUPAC name of 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one (CID 14456877) is 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one is CN1C(=O)OCC1CO.
What is the InChIKey of 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one?
The InChIKey is UWUDQTYKCUFKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-6-4(2-7)3-9-5(6)8/h4,7H,2-3H2,1H3.
What are the key properties of 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one?
4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one has a molecular weight of 131.13 g/mol, XLogP of -0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-3-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 14456877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).