C13H22O3 — CID 144568929
methyl 2-[(1S)-3-oxocyclopentyl]acetate;(Z)-pent-2-ene (PubChem CID 144568929) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is methyl 2-[(1S)-3-oxocyclopentyl]acetate;(Z)-pent-2-ene.
| Compound Name | methyl 2-[(1S)-3-oxocyclopentyl]acetate;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 144568929 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | methyl 2-[(1S)-3-oxocyclopentyl]acetate;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.COC(=O)C[C@H]1CCC(=O)C1 |
| InChI | InChI=1S/C8H12O3.C5H10/c1-11-8(10)5-6-2-3-7(9)4-6;1-3-5-4-2/h6H,2-5H2,1H3;3,5H,4H2,1-2H3/b;5-3-/t6-;/m0./s1 |
| InChIKey | BPMLJHJLEUNHGK-JRORSJHPSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|