C27H36N4O — CID 144571558
(1E,4E,6E)-1,7-bis[6-(diethylamino)-3-pyridinyl]-4,5-dimethylhepta-1,4,6-trien-3-one (PubChem CID 144571558) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is (1E,4E,6E)-1,7-bis[6-(diethylamino)-3-pyridinyl]-4,5-dimethylhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-1,7-bis[6-(diethylamino)-3-pyridinyl]-4,5-dimethylhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 144571558 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (1E,4E,6E)-1,7-bis[6-(diethylamino)-3-pyridinyl]-4,5-dimethylhepta-1,4,6-trien-3-one |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)/C(C)=C(C)/C=C/c2ccc(N(CC)CC)nc2)cn1 |
| InChI | InChI=1S/C27H36N4O/c1-7-30(8-2)26-17-14-23(19-28-26)12-11-21(5)22(6)25(32)16-13-24-15-18-27(29-20-24)31(9-3)10-4/h11-20H,7-10H2,1-6H3/b12-11+,16-13+,22-21+ |
| InChIKey | XFKOLAHCOFBIBI-RYYIMJMGSA-N |
| XLogP | 5.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|