About (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one
(3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one (PubChem CID 2265240) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one.
Molecular Properties
| Compound Name | (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one |
| PubChem CID | 2265240 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one |
| SMILES | CN1C/C(=C/c2cccnc2)C(=O)/C(=C/c2cccnc2)C1 |
| InChI | InChI=1S/C18H17N3O/c1-21-12-16(8-14-4-2-6-19-10-14)18(22)17(13-21)9-15-5-3-7-20-11-15/h2-11H,12-13H2,1H3/b16-8-,17-9+ |
| InChIKey | JUTNPNBAQUDRSX-VAQFQWRASA-N |
| XLogP | 2.46 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one?
The IUPAC name of (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one (CID 2265240) is (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one.
What is the SMILES notation for (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one?
The canonical SMILES for (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one is CN1C/C(=C/c2cccnc2)C(=O)/C(=C/c2cccnc2)C1.
What is the InChIKey of (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one?
The InChIKey is JUTNPNBAQUDRSX-VAQFQWRASA-N. The full InChI is InChI=1S/C18H17N3O/c1-21-12-16(8-14-4-2-6-19-10-14)18(22)17(13-21)9-15-5-3-7-20-11-15/h2-11H,12-13H2,1H3/b16-8-,17-9+.
What are the key properties of (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one?
(3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one has a molecular weight of 291.35 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-1-methyl-3,5-bis(pyridin-3-ylmethylidene)piperidin-4-one is sourced from PubChem (CID 2265240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).