C27H29FN8O3 — CID 144571598
1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[hydroxy-(1-methylimidazol-2-yl)-phenylmethyl]piperidin-1-yl]ethane-1,2-dione (PubChem CID 144571598) has the molecular formula C27H29FN8O3 and a molecular weight of 532.58 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[hydroxy-(1-methylimidazol-2-yl)-phenylmethyl]piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[hydroxy-(1-methylimidazol-2-yl)-phenylmethyl]piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 144571598 |
| Molecular Formula | C27H29FN8O3 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[hydroxy-(1-methylimidazol-2-yl)-phenylmethyl]piperidin-1-yl]ethane-1,2-dione |
| SMILES | Cn1ccnc1C(O)(c1ccccc1)C1CCN(C(=O)C(=O)c2c[nH]c3c(N(N)/C=C\N)ncc(F)c23)CC1 |
| InChI | InChI=1S/C27H29FN8O3/c1-34-14-10-31-26(34)27(39,17-5-3-2-4-6-17)18-7-11-35(12-8-18)25(38)23(37)19-15-32-22-21(19)20(28)16-33-24(22)36(30)13-9-29/h2-6,9-10,13-16,18,32,39H,7-8,11-12,29-30H2,1H3/b13-9- |
| InChIKey | WDUPFBPWBFVLAX-LCYFTJDESA-N |
| XLogP | 1.90 |
| TPSA | 159.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|