C12H18Cl2N2O — CID 144572037
4,5-dichloro-2-cyclohexylpyridazin-3-one;ethane (PubChem CID 144572037) has the molecular formula C12H18Cl2N2O and a molecular weight of 277.19 g/mol. Its IUPAC name is 4,5-dichloro-2-cyclohexylpyridazin-3-one;ethane.
| Compound Name | 4,5-dichloro-2-cyclohexylpyridazin-3-one;ethane |
|---|---|
| PubChem CID | 144572037 |
| Molecular Formula | C12H18Cl2N2O |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4,5-dichloro-2-cyclohexylpyridazin-3-one;ethane |
| SMILES | CC.O=c1c(Cl)c(Cl)cnn1C1CCCCC1 |
| InChI | InChI=1S/C10H12Cl2N2O.C2H6/c11-8-6-13-14(10(15)9(8)12)7-4-2-1-3-5-7;1-2/h6-7H,1-5H2;1-2H3 |
| InChIKey | GZHAFAWIRARFLO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |