C17H21Cl2N3O — CID 144572125
1-[(2E,4Z)-4-[2-(2,5-dichloropyrimidin-4-yl)ethyl]hepta-2,4-dien-3-yl]cyclopropane-1-carboxamide (PubChem CID 144572125) has the molecular formula C17H21Cl2N3O and a molecular weight of 354.28 g/mol. Its IUPAC name is 1-[(2E,4Z)-4-[2-(2,5-dichloropyrimidin-4-yl)ethyl]hepta-2,4-dien-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-[(2E,4Z)-4-[2-(2,5-dichloropyrimidin-4-yl)ethyl]hepta-2,4-dien-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 144572125 |
| Molecular Formula | C17H21Cl2N3O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 1-[(2E,4Z)-4-[2-(2,5-dichloropyrimidin-4-yl)ethyl]hepta-2,4-dien-3-yl]cyclopropane-1-carboxamide |
| SMILES | C/C=C(C(=C/CC)\CCc1nc(Cl)ncc1Cl)/C1(C(N)=O)CC1 |
| InChI | InChI=1S/C17H21Cl2N3O/c1-3-5-11(12(4-2)17(8-9-17)15(20)23)6-7-14-13(18)10-21-16(19)22-14/h4-5,10H,3,6-9H2,1-2H3,(H2,20,23)/b11-5-,12-4+ |
| InChIKey | BZDSTWCUJLWKLT-FYXNRHCTSA-N |
| XLogP | 4.26 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|