C16H15Cl2N3O — CID 144572152
2-[6-[2-(2,5-dichloropyrimidin-4-yl)ethynyl]cyclohexa-1,5-dien-1-yl]-2-methylpropanamide (PubChem CID 144572152) has the molecular formula C16H15Cl2N3O and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-[6-[2-(2,5-dichloropyrimidin-4-yl)ethynyl]cyclohexa-1,5-dien-1-yl]-2-methylpropanamide.
| Compound Name | 2-[6-[2-(2,5-dichloropyrimidin-4-yl)ethynyl]cyclohexa-1,5-dien-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 144572152 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[6-[2-(2,5-dichloropyrimidin-4-yl)ethynyl]cyclohexa-1,5-dien-1-yl]-2-methylpropanamide |
| SMILES | CC(C)(C(N)=O)C1=CCCC=C1C#Cc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C16H15Cl2N3O/c1-16(2,14(19)22)11-6-4-3-5-10(11)7-8-13-12(17)9-20-15(18)21-13/h5-6,9H,3-4H2,1-2H3,(H2,19,22) |
| InChIKey | RZMZZUMBSFHPSF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|