About methanimine;N-methylpent-1-en-3-imine
methanimine;N-methylpent-1-en-3-imine (PubChem CID 144572310) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is methanimine;N-methylpent-1-en-3-imine.
Molecular Properties
| Compound Name | methanimine;N-methylpent-1-en-3-imine |
| PubChem CID | 144572310 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | methanimine;N-methylpent-1-en-3-imine |
| SMILES | C=C/C(CC)=N\C.[H]N=C |
| InChI | InChI=1S/C6H11N.CH3N/c1-4-6(5-2)7-3;1-2/h4H,1,5H2,2-3H3;2H,1H2/b7-6+; |
| InChIKey | UAZMJBSUXJOHSX-UHDJGPCESA-N |
| XLogP | 1.92 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methanimine;N-methylpent-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimine;N-methylpent-1-en-3-imine?
The IUPAC name of methanimine;N-methylpent-1-en-3-imine (CID 144572310) is methanimine;N-methylpent-1-en-3-imine.
What is the SMILES notation for methanimine;N-methylpent-1-en-3-imine?
The canonical SMILES for methanimine;N-methylpent-1-en-3-imine is C=C/C(CC)=N\C.[H]N=C.
What is the InChIKey of methanimine;N-methylpent-1-en-3-imine?
The InChIKey is UAZMJBSUXJOHSX-UHDJGPCESA-N. The full InChI is InChI=1S/C6H11N.CH3N/c1-4-6(5-2)7-3;1-2/h4H,1,5H2,2-3H3;2H,1H2/b7-6+;.
What are the key properties of methanimine;N-methylpent-1-en-3-imine?
methanimine;N-methylpent-1-en-3-imine has a molecular weight of 126.20 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;N-methylpent-1-en-3-imine is sourced from PubChem (CID 144572310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).