C5H8N2 — CID 123891482
pent-4-ene-1,3-diimine (PubChem CID 123891482) has the molecular formula C5H8N2 and a molecular weight of 96.13 g/mol. Its IUPAC name is pent-4-ene-1,3-diimine.
| Compound Name | pent-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 123891482 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | pent-4-ene-1,3-diimine |
| SMILES | [H]/N=C(\C=C)C/C=N/[H] |
| InChI | InChI=1S/C5H8N2/c1-2-5(7)3-4-6/h2,4,6-7H,1,3H2/b6-4+,7-5+ |
| InChIKey | PTSFWPISWVDOIJ-YDFGWWAZSA-N |
| XLogP | 1.23 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|