C22H16ClF4N3O — CID 144572402
2-chloro-N-[2-(2-fluorobenzenecarboximidoyl)-5-(methylamino)phenyl]-6-(trifluoromethyl)benzamide (PubChem CID 144572402) has the molecular formula C22H16ClF4N3O and a molecular weight of 449.84 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-fluorobenzenecarboximidoyl)-5-(methylamino)phenyl]-6-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[2-(2-fluorobenzenecarboximidoyl)-5-(methylamino)phenyl]-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 144572402 |
| Molecular Formula | C22H16ClF4N3O |
| Molecular Weight | 449.84 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 2-chloro-N-[2-(2-fluorobenzenecarboximidoyl)-5-(methylamino)phenyl]-6-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\c1ccccc1F)c1ccc(NC)cc1NC(=O)c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H16ClF4N3O/c1-29-12-9-10-14(20(28)13-5-2-3-8-17(13)24)18(11-12)30-21(31)19-15(22(25,26)27)6-4-7-16(19)23/h2-11,28-29H,1H3,(H,30,31)/b28-20+ |
| InChIKey | JAXPTQVZKTYEJL-VFCFBJKWSA-N |
| XLogP | 6.21 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|