C19H13BrN2O3S — CID 144572591
(2Z)-2-[(3-bromo-4,5-dihydroxyphenyl)methylidene]-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one (PubChem CID 144572591) has the molecular formula C19H13BrN2O3S and a molecular weight of 429.30 g/mol. Its IUPAC name is (2Z)-2-[(3-bromo-4,5-dihydroxyphenyl)methylidene]-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one.
| Compound Name | (2Z)-2-[(3-bromo-4,5-dihydroxyphenyl)methylidene]-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one |
|---|---|
| PubChem CID | 144572591 |
| Molecular Formula | C19H13BrN2O3S |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | (2Z)-2-[(3-bromo-4,5-dihydroxyphenyl)methylidene]-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one |
| SMILES | Cc1ccc(-c2cn3c(=O)/c(=C/c4cc(O)c(O)c(Br)c4)sc3n2)cc1 |
| InChI | InChI=1S/C19H13BrN2O3S/c1-10-2-4-12(5-3-10)14-9-22-18(25)16(26-19(22)21-14)8-11-6-13(20)17(24)15(23)7-11/h2-9,23-24H,1H3/b16-8- |
| InChIKey | FZRCSNARNIPQNS-PXNMLYILSA-N |
| XLogP | 3.45 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|