C18H14BrNO2S — CID 123761697
3-bromo-5-[[4-methylidene-2-(4-methylphenyl)-1,3-thiazol-5-ylidene]methyl]benzene-1,2-diol (PubChem CID 123761697) has the molecular formula C18H14BrNO2S and a molecular weight of 388.29 g/mol. Its IUPAC name is 3-bromo-5-[[4-methylidene-2-(4-methylphenyl)-1,3-thiazol-5-ylidene]methyl]benzene-1,2-diol.
| Compound Name | 3-bromo-5-[[4-methylidene-2-(4-methylphenyl)-1,3-thiazol-5-ylidene]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 123761697 |
| Molecular Formula | C18H14BrNO2S |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 3-bromo-5-[[4-methylidene-2-(4-methylphenyl)-1,3-thiazol-5-ylidene]methyl]benzene-1,2-diol |
| SMILES | C=c1nc(-c2ccc(C)cc2)sc1=Cc1cc(O)c(O)c(Br)c1 |
| InChI | InChI=1S/C18H14BrNO2S/c1-10-3-5-13(6-4-10)18-20-11(2)16(23-18)9-12-7-14(19)17(22)15(21)8-12/h3-9,21-22H,2H2,1H3 |
| InChIKey | LJDSWYNMKBJBBY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|