C20H20N4O3S — CID 144572813
2-[3-(methylsulfanylmethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidine-7-carbaldehyde (PubChem CID 144572813) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[3-(methylsulfanylmethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidine-7-carbaldehyde.
| Compound Name | 2-[3-(methylsulfanylmethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidine-7-carbaldehyde |
|---|---|
| PubChem CID | 144572813 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[3-(methylsulfanylmethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidine-7-carbaldehyde |
| SMILES | CSCOc1cccc(-c2nc(N3CCOCC3)c3ncc(C=O)cc3n2)c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-28-13-27-16-4-2-3-15(10-16)19-22-17-9-14(12-25)11-21-18(17)20(23-19)24-5-7-26-8-6-24/h2-4,9-12H,5-8,13H2,1H3 |
| InChIKey | QXDCZNQAIZNFNR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|