C13H14O — CID 144572953
1-ethynyl-2-(3-methoxybut-3-en-2-yl)benzene (PubChem CID 144572953) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-ethynyl-2-(3-methoxybut-3-en-2-yl)benzene.
| Compound Name | 1-ethynyl-2-(3-methoxybut-3-en-2-yl)benzene |
|---|---|
| PubChem CID | 144572953 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-ethynyl-2-(3-methoxybut-3-en-2-yl)benzene |
| SMILES | C#Cc1ccccc1C(C)C(=C)OC |
| InChI | InChI=1S/C13H14O/c1-5-12-8-6-7-9-13(12)10(2)11(3)14-4/h1,6-10H,3H2,2,4H3 |
| InChIKey | OJERVRATENLPCE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|