C15H25NO — CID 144575301
2-[1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidin-2-yl]ethanol (PubChem CID 144575301) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-[1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 144575301 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-[1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidin-2-yl]ethanol |
| SMILES | C=C/C=C\C(=C/C)CN1CCCCC1CCO |
| InChI | InChI=1S/C15H25NO/c1-3-5-8-14(4-2)13-16-11-7-6-9-15(16)10-12-17/h3-5,8,15,17H,1,6-7,9-13H2,2H3/b8-5-,14-4+ |
| InChIKey | BMXZBLFRMVWETK-CQXJEZQLSA-N |
| XLogP | 2.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|