C15H26BrNO — CID 15358964
2-[1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]ethanol (PubChem CID 15358964) has the molecular formula C15H26BrNO and a molecular weight of 316.28 g/mol. Its IUPAC name is 2-[1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 15358964 |
| Molecular Formula | C15H26BrNO |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]ethanol |
| SMILES | CC(C)/C=C(Br)/C=C/CN1CCCCC1CCO |
| InChI | InChI=1S/C15H26BrNO/c1-13(2)12-14(16)6-5-10-17-9-4-3-7-15(17)8-11-18/h5-6,12-13,15,18H,3-4,7-11H2,1-2H3/b6-5+,14-12- |
| InChIKey | BIFRMBQULAKEEB-LAXYHDMGSA-N |
| XLogP | 3.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|