C13H22BrNO — CID 15358962
2-[1-[(2E,4Z)-4-bromohexa-2,4-dienyl]piperidin-2-yl]ethanol (PubChem CID 15358962) has the molecular formula C13H22BrNO and a molecular weight of 288.23 g/mol. Its IUPAC name is 2-[1-[(2E,4Z)-4-bromohexa-2,4-dienyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[(2E,4Z)-4-bromohexa-2,4-dienyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 15358962 |
| Molecular Formula | C13H22BrNO |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[1-[(2E,4Z)-4-bromohexa-2,4-dienyl]piperidin-2-yl]ethanol |
| SMILES | C/C=C(Br)/C=C/CN1CCCCC1CCO |
| InChI | InChI=1S/C13H22BrNO/c1-2-12(14)6-5-10-15-9-4-3-7-13(15)8-11-16/h2,5-6,13,16H,3-4,7-11H2,1H3/b6-5+,12-2- |
| InChIKey | XOBGJUPDRQMTHE-DDPXZRBBSA-N |
| XLogP | 3.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|