C14H24BrNO — CID 15358965
[1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]methanol (PubChem CID 15358965) has the molecular formula C14H24BrNO and a molecular weight of 302.26 g/mol. Its IUPAC name is [1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]methanol.
| Compound Name | [1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 15358965 |
| Molecular Formula | C14H24BrNO |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]piperidin-2-yl]methanol |
| SMILES | CC(C)/C=C(Br)/C=C/CN1CCCCC1CO |
| InChI | InChI=1S/C14H24BrNO/c1-12(2)10-13(15)6-5-9-16-8-4-3-7-14(16)11-17/h5-6,10,12,14,17H,3-4,7-9,11H2,1-2H3/b6-5+,13-10- |
| InChIKey | ATPYZUFZBRLIBR-KWQUGSDZSA-N |
| XLogP | 3.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|