C12H21NO — CID 144575298
[1-[(Z)-2-methylidenepent-3-enyl]piperidin-2-yl]methanol (PubChem CID 144575298) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is [1-[(Z)-2-methylidenepent-3-enyl]piperidin-2-yl]methanol.
| Compound Name | [1-[(Z)-2-methylidenepent-3-enyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 144575298 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | [1-[(Z)-2-methylidenepent-3-enyl]piperidin-2-yl]methanol |
| SMILES | C=C(/C=C\C)CN1CCCCC1CO |
| InChI | InChI=1S/C12H21NO/c1-3-6-11(2)9-13-8-5-4-7-12(13)10-14/h3,6,12,14H,2,4-5,7-10H2,1H3/b6-3- |
| InChIKey | LZDXWUPSZXSSPN-UTCJRWHESA-N |
| XLogP | 1.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|