C14H24NO2+ — CID 91218835
1-(cyclohexa-1,5-dien-1-ylmethyl)-1-methoxy-6-methylpiperidin-1-ium-3-ol (PubChem CID 91218835) has the molecular formula C14H24NO2+ and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-1-methoxy-6-methylpiperidin-1-ium-3-ol.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-1-methoxy-6-methylpiperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 91218835 |
| Molecular Formula | C14H24NO2+ |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-1-methoxy-6-methylpiperidin-1-ium-3-ol |
| SMILES | CO[N+]1(CC2=CCCC=C2)CC(O)CCC1C |
| InChI | InChI=1S/C14H24NO2/c1-12-8-9-14(16)11-15(12,17-2)10-13-6-4-3-5-7-13/h4,6-7,12,14,16H,3,5,8-11H2,1-2H3/q+1 |
| InChIKey | YUJSSLPNFCBGLB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|