C17H31NO2 — CID 157039517
1-[(Z,5Z)-5-ethylidenenon-6-enyl]-2-(hydroxymethyl)piperidin-4-ol (PubChem CID 157039517) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-[(Z,5Z)-5-ethylidenenon-6-enyl]-2-(hydroxymethyl)piperidin-4-ol.
| Compound Name | 1-[(Z,5Z)-5-ethylidenenon-6-enyl]-2-(hydroxymethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 157039517 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 1-[(Z,5Z)-5-ethylidenenon-6-enyl]-2-(hydroxymethyl)piperidin-4-ol |
| SMILES | C/C=C(\C=C/CC)CCCCN1CCC(O)CC1CO |
| InChI | InChI=1S/C17H31NO2/c1-3-5-8-15(4-2)9-6-7-11-18-12-10-17(20)13-16(18)14-19/h4-5,8,16-17,19-20H,3,6-7,9-14H2,1-2H3/b8-5-,15-4+ |
| InChIKey | RIFJZMOSSJJBBI-YGIGUCEYSA-N |
| XLogP | 2.89 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|