C13H21NO2 — CID 90711064
1-(1-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)piperidin-4-ol (PubChem CID 90711064) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(1-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)piperidin-4-ol.
| Compound Name | 1-(1-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 90711064 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-(1-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)piperidin-4-ol |
| SMILES | OCC(C1=CCCC=C1)N1CCC(O)CC1 |
| InChI | InChI=1S/C13H21NO2/c15-10-13(11-4-2-1-3-5-11)14-8-6-12(16)7-9-14/h2,4-5,12-13,15-16H,1,3,6-10H2 |
| InChIKey | IQRINJKPIFRYBC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |