C15H25NO — CID 15939795
(2S,5E)-5-[(9aR)-1-methyl-4,6,7,8,9,9a-hexahydroquinolizin-3-ylidene]pentan-2-ol (PubChem CID 15939795) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2S,5E)-5-[(9aR)-1-methyl-4,6,7,8,9,9a-hexahydroquinolizin-3-ylidene]pentan-2-ol.
| Compound Name | (2S,5E)-5-[(9aR)-1-methyl-4,6,7,8,9,9a-hexahydroquinolizin-3-ylidene]pentan-2-ol |
|---|---|
| PubChem CID | 15939795 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2S,5E)-5-[(9aR)-1-methyl-4,6,7,8,9,9a-hexahydroquinolizin-3-ylidene]pentan-2-ol |
| SMILES | CC1=C/C(=C\CC[C@H](C)O)CN2CCCC[C@H]12 |
| InChI | InChI=1S/C15H25NO/c1-12-10-14(7-5-6-13(2)17)11-16-9-4-3-8-15(12)16/h7,10,13,15,17H,3-6,8-9,11H2,1-2H3/b14-7+/t13-,15+/m0/s1 |
| InChIKey | AHEJLXVLILVPHL-CTXSEGDPSA-N |
| XLogP | 2.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |