C13H22BrNO — CID 15358966
[(2S)-1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]pyrrolidin-2-yl]methanol (PubChem CID 15358966) has the molecular formula C13H22BrNO and a molecular weight of 288.23 g/mol. Its IUPAC name is [(2S)-1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 15358966 |
| Molecular Formula | C13H22BrNO |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [(2S)-1-[(2E,4Z)-4-bromo-6-methylhepta-2,4-dienyl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)/C=C(Br)/C=C/CN1CCC[C@H]1CO |
| InChI | InChI=1S/C13H22BrNO/c1-11(2)9-12(14)5-3-7-15-8-4-6-13(15)10-16/h3,5,9,11,13,16H,4,6-8,10H2,1-2H3/b5-3+,12-9-/t13-/m0/s1 |
| InChIKey | QMANKAFZHADRCX-ZSYYEROASA-N |
| XLogP | 2.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|