C11H18BrNO — CID 10989020
[(2S)-1-[(2E,4Z)-4-bromohexa-2,4-dienyl]pyrrolidin-2-yl]methanol (PubChem CID 10989020) has the molecular formula C11H18BrNO and a molecular weight of 260.17 g/mol. Its IUPAC name is [(2S)-1-[(2E,4Z)-4-bromohexa-2,4-dienyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(2E,4Z)-4-bromohexa-2,4-dienyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 10989020 |
| Molecular Formula | C11H18BrNO |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [(2S)-1-[(2E,4Z)-4-bromohexa-2,4-dienyl]pyrrolidin-2-yl]methanol |
| SMILES | C/C=C(Br)/C=C/CN1CCC[C@H]1CO |
| InChI | InChI=1S/C11H18BrNO/c1-2-10(12)5-3-7-13-8-4-6-11(13)9-14/h2-3,5,11,14H,4,6-9H2,1H3/b5-3+,10-2-/t11-/m0/s1 |
| InChIKey | XJCMZEXQHMQBLT-ZKXFMLHBSA-N |
| XLogP | 2.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|