C13H23NO — CID 144575344
2-[1-[(E)-2-ethenylbut-2-enyl]piperidin-2-yl]ethanol (PubChem CID 144575344) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-[1-[(E)-2-ethenylbut-2-enyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[(E)-2-ethenylbut-2-enyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 144575344 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-[1-[(E)-2-ethenylbut-2-enyl]piperidin-2-yl]ethanol |
| SMILES | C=C/C(=C\C)CN1CCCCC1CCO |
| InChI | InChI=1S/C13H23NO/c1-3-12(4-2)11-14-9-6-5-7-13(14)8-10-15/h3-4,13,15H,1,5-11H2,2H3/b12-4+ |
| InChIKey | NLBGNNZTXDFZRZ-UUILKARUSA-N |
| XLogP | 2.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|