C26H36F4N4O8S — CID 144576374
benzyl (2S)-2-[[2-[[(2S)-3-(difluoromethoxy)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]-2-(difluoromethoxysulfanyl)acetyl]amino]-4-methylpentanoate (PubChem CID 144576374) has the molecular formula C26H36F4N4O8S and a molecular weight of 640.65 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-[[(2S)-3-(difluoromethoxy)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]-2-(difluoromethoxysulfanyl)acetyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[2-[[(2S)-3-(difluoromethoxy)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]-2-(difluoromethoxysulfanyl)acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 144576374 |
| Molecular Formula | C26H36F4N4O8S |
| Molecular Weight | 640.65 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | benzyl (2S)-2-[[2-[[(2S)-3-(difluoromethoxy)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]-2-(difluoromethoxysulfanyl)acetyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)C(NC(=O)[C@H](COC(F)F)NC(=O)CN1CCOCC1)SOC(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H36F4N4O8S/c1-16(2)12-18(24(38)40-14-17-6-4-3-5-7-17)32-22(37)23(43-42-26(29)30)33-21(36)19(15-41-25(27)28)31-20(35)13-34-8-10-39-11-9-34/h3-7,16,18-19,23,25-26H,8-15H2,1-2H3,(H,31,35)(H,32,37)(H,33,36)/t18-,19-,23?/m0/s1 |
| InChIKey | TWOZIEFRVJOVSC-GVLQVIKUSA-N |
| XLogP | 1.65 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.65 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|