About ethane;morpholine-3-carboxylic acid
ethane;morpholine-3-carboxylic acid (PubChem CID 144576497) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is ethane;morpholine-3-carboxylic acid.
Molecular Properties
| Compound Name | ethane;morpholine-3-carboxylic acid |
| PubChem CID | 144576497 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | ethane;morpholine-3-carboxylic acid |
| SMILES | CC.O=C(O)C1COCCN1 |
| InChI | InChI=1S/C5H9NO3.C2H6/c7-5(8)4-3-9-2-1-6-4;1-2/h4,6H,1-3H2,(H,7,8);1-2H3 |
| InChIKey | LIOFEPALIPJNOA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;morpholine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;morpholine-3-carboxylic acid?
The IUPAC name of ethane;morpholine-3-carboxylic acid (CID 144576497) is ethane;morpholine-3-carboxylic acid.
What is the SMILES notation for ethane;morpholine-3-carboxylic acid?
The canonical SMILES for ethane;morpholine-3-carboxylic acid is CC.O=C(O)C1COCCN1.
What is the InChIKey of ethane;morpholine-3-carboxylic acid?
The InChIKey is LIOFEPALIPJNOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.C2H6/c7-5(8)4-3-9-2-1-6-4;1-2/h4,6H,1-3H2,(H,7,8);1-2H3.
What are the key properties of ethane;morpholine-3-carboxylic acid?
ethane;morpholine-3-carboxylic acid has a molecular weight of 161.20 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;morpholine-3-carboxylic acid is sourced from PubChem (CID 144576497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).