C13H31NO3 — CID 144576606
ethane;2-[(4-methylmorpholin-3-yl)methyl]propane-1,3-diol (PubChem CID 144576606) has the molecular formula C13H31NO3 and a molecular weight of 249.39 g/mol. Its IUPAC name is ethane;2-[(4-methylmorpholin-3-yl)methyl]propane-1,3-diol.
| Compound Name | ethane;2-[(4-methylmorpholin-3-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 144576606 |
| Molecular Formula | C13H31NO3 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | ethane;2-[(4-methylmorpholin-3-yl)methyl]propane-1,3-diol |
| SMILES | CC.CC.CN1CCOCC1CC(CO)CO |
| InChI | InChI=1S/C9H19NO3.2C2H6/c1-10-2-3-13-7-9(10)4-8(5-11)6-12;2*1-2/h8-9,11-12H,2-7H2,1H3;2*1-2H3 |
| InChIKey | ZWETYMHLOBNWHL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |