C20H29N3O6 — CID 144580325
tert-butyl N-methyl-N-[[(3R)-3-methyl-9-nitro-5-oxo-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-2-yl]methyl]carbamate (PubChem CID 144580325) has the molecular formula C20H29N3O6 and a molecular weight of 407.47 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[(3R)-3-methyl-9-nitro-5-oxo-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[(3R)-3-methyl-9-nitro-5-oxo-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 144580325 |
| Molecular Formula | C20H29N3O6 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | tert-butyl N-methyl-N-[[(3R)-3-methyl-9-nitro-5-oxo-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-2-yl]methyl]carbamate |
| SMILES | CC(C)N1C(=O)c2cccc([N+](=O)[O-])c2OC(CN(C)C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C20H29N3O6/c1-12(2)22-13(3)16(11-21(7)19(25)29-20(4,5)6)28-17-14(18(22)24)9-8-10-15(17)23(26)27/h8-10,12-13,16H,11H2,1-7H3/t13-,16?/m1/s1 |
| InChIKey | YPVMFUOXPHCOLJ-JBZHPUCOSA-N |
| XLogP | 3.46 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|