C18H24FN5O4 — CID 170600279
tert-butyl N-[1-[2-ethyl-5-(2-fluoro-3-nitrophenyl)triazol-4-yl]ethyl]-N-methylcarbamate (PubChem CID 170600279) has the molecular formula C18H24FN5O4 and a molecular weight of 393.42 g/mol. Its IUPAC name is tert-butyl N-[1-[2-ethyl-5-(2-fluoro-3-nitrophenyl)triazol-4-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[2-ethyl-5-(2-fluoro-3-nitrophenyl)triazol-4-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170600279 |
| Molecular Formula | C18H24FN5O4 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | tert-butyl N-[1-[2-ethyl-5-(2-fluoro-3-nitrophenyl)triazol-4-yl]ethyl]-N-methylcarbamate |
| SMILES | CCn1nc(-c2cccc([N+](=O)[O-])c2F)c(C(C)N(C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C18H24FN5O4/c1-7-23-20-15(11(2)22(6)17(25)28-18(3,4)5)16(21-23)12-9-8-10-13(14(12)19)24(26)27/h8-11H,7H2,1-6H3 |
| InChIKey | OXQFFTGKKMVAGF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|