C19H19F4N3O4 — CID 164902685
tert-butyl N-[dideuterio-[2-(2-fluoro-3-nitrophenyl)-6-(trifluoromethyl)-3-pyridinyl]methyl]-N-methylcarbamate (PubChem CID 164902685) has the molecular formula C19H19F4N3O4 and a molecular weight of 431.38 g/mol. Its IUPAC name is tert-butyl N-[dideuterio-[2-(2-fluoro-3-nitrophenyl)-6-(trifluoromethyl)-3-pyridinyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[dideuterio-[2-(2-fluoro-3-nitrophenyl)-6-(trifluoromethyl)-3-pyridinyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 164902685 |
| Molecular Formula | C19H19F4N3O4 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | tert-butyl N-[dideuterio-[2-(2-fluoro-3-nitrophenyl)-6-(trifluoromethyl)-3-pyridinyl]methyl]-N-methylcarbamate |
| SMILES | [2H]C([2H])(c1ccc(C(F)(F)F)nc1-c1cccc([N+](=O)[O-])c1F)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H19F4N3O4/c1-18(2,3)30-17(27)25(4)10-11-8-9-14(19(21,22)23)24-16(11)12-6-5-7-13(15(12)20)26(28)29/h5-9H,10H2,1-4H3/i10D2 |
| InChIKey | LMJNLYBRLZRCGG-KBMKNGFXSA-N |
| XLogP | 5.18 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|