About N-butylacetamide;pyrrolidin-2-ylmethanol
N-butylacetamide;pyrrolidin-2-ylmethanol (PubChem CID 144581218) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is N-butylacetamide;pyrrolidin-2-ylmethanol.
Molecular Properties
| Compound Name | N-butylacetamide;pyrrolidin-2-ylmethanol |
| PubChem CID | 144581218 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-butylacetamide;pyrrolidin-2-ylmethanol |
| SMILES | CCCCNC(C)=O.OCC1CCCN1 |
| InChI | InChI=1S/C6H13NO.C5H11NO/c1-3-4-5-7-6(2)8;7-4-5-2-1-3-6-5/h3-5H2,1-2H3,(H,7,8);5-7H,1-4H2 |
| InChIKey | WDNUQJFSLITYED-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylacetamide;pyrrolidin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylacetamide;pyrrolidin-2-ylmethanol?
The IUPAC name of N-butylacetamide;pyrrolidin-2-ylmethanol (CID 144581218) is N-butylacetamide;pyrrolidin-2-ylmethanol.
What is the SMILES notation for N-butylacetamide;pyrrolidin-2-ylmethanol?
The canonical SMILES for N-butylacetamide;pyrrolidin-2-ylmethanol is CCCCNC(C)=O.OCC1CCCN1.
What is the InChIKey of N-butylacetamide;pyrrolidin-2-ylmethanol?
The InChIKey is WDNUQJFSLITYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C5H11NO/c1-3-4-5-7-6(2)8;7-4-5-2-1-3-6-5/h3-5H2,1-2H3,(H,7,8);5-7H,1-4H2.
What are the key properties of N-butylacetamide;pyrrolidin-2-ylmethanol?
N-butylacetamide;pyrrolidin-2-ylmethanol has a molecular weight of 216.32 g/mol, XLogP of 0.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylacetamide;pyrrolidin-2-ylmethanol is sourced from PubChem (CID 144581218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).