C17H23O2S+ — CID 144582741
4-(4-methoxy-2,3-dihydronaphthalen-1-yl)-2,6-dimethyl-1,4-oxathian-4-ium (PubChem CID 144582741) has the molecular formula C17H23O2S+ and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-(4-methoxy-2,3-dihydronaphthalen-1-yl)-2,6-dimethyl-1,4-oxathian-4-ium.
| Compound Name | 4-(4-methoxy-2,3-dihydronaphthalen-1-yl)-2,6-dimethyl-1,4-oxathian-4-ium |
|---|---|
| PubChem CID | 144582741 |
| Molecular Formula | C17H23O2S+ |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-(4-methoxy-2,3-dihydronaphthalen-1-yl)-2,6-dimethyl-1,4-oxathian-4-ium |
| SMILES | COC1=c2ccccc2=C([S+]2CC(C)OC(C)C2)CC1 |
| InChI | InChI=1S/C17H23O2S/c1-12-10-20(11-13(2)19-12)17-9-8-16(18-3)14-6-4-5-7-15(14)17/h4-7,12-13H,8-11H2,1-3H3/q+1 |
| InChIKey | ISZOFTIWVCZGQI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|