About 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine
3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine (PubChem CID 144584790) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine.
Molecular Properties
| Compound Name | 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine |
| PubChem CID | 144584790 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine |
| SMILES | CCn1ccc(CCC(=O)O)n1.CN |
| InChI | InChI=1S/C8H12N2O2.CH5N/c1-2-10-6-5-7(9-10)3-4-8(11)12;1-2/h5-6H,2-4H2,1H3,(H,11,12);2H2,1H3 |
| InChIKey | MMSIYGGNEOABQT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine?
The IUPAC name of 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine (CID 144584790) is 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine.
What is the SMILES notation for 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine?
The canonical SMILES for 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine is CCn1ccc(CCC(=O)O)n1.CN.
What is the InChIKey of 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine?
The InChIKey is MMSIYGGNEOABQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.CH5N/c1-2-10-6-5-7(9-10)3-4-8(11)12;1-2/h5-6H,2-4H2,1H3,(H,11,12);2H2,1H3.
What are the key properties of 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine?
3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine has a molecular weight of 199.25 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethylpyrazol-3-yl)propanoic acid;methanamine is sourced from PubChem (CID 144584790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).