C14H18ClN3O2 — CID 126966178
2-[[(1-ethylpyrazol-3-yl)methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 126966178) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-[[(1-ethylpyrazol-3-yl)methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 2-[[(1-ethylpyrazol-3-yl)methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 126966178 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-[[(1-ethylpyrazol-3-yl)methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | CCn1ccc(CNCc2ccccc2C(=O)O)n1.Cl |
| InChI | InChI=1S/C14H17N3O2.ClH/c1-2-17-8-7-12(16-17)10-15-9-11-5-3-4-6-13(11)14(18)19;/h3-8,15H,2,9-10H2,1H3,(H,18,19);1H |
| InChIKey | VIVYQBDLBWXBRA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |