C17H18N4O2 — CID 19621343
2-[[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]methyl]benzoic acid (PubChem CID 19621343) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]methyl]benzoic acid.
| Compound Name | 2-[[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 19621343 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]methyl]benzoic acid |
| SMILES | CCn1cc(-c2ccn(Cc3ccccc3C(=O)O)n2)c(C)n1 |
| InChI | InChI=1S/C17H18N4O2/c1-3-20-11-15(12(2)18-20)16-8-9-21(19-16)10-13-6-4-5-7-14(13)17(22)23/h4-9,11H,3,10H2,1-2H3,(H,22,23) |
| InChIKey | KNSJEDXXZUCABN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |