C11H17N5 — CID 19621340
2-[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]ethanamine (PubChem CID 19621340) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]ethanamine.
| Compound Name | 2-[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 19621340 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-[3-(1-ethyl-3-methylpyrazol-4-yl)pyrazol-1-yl]ethanamine |
| SMILES | CCn1cc(-c2ccn(CCN)n2)c(C)n1 |
| InChI | InChI=1S/C11H17N5/c1-3-15-8-10(9(2)13-15)11-4-6-16(14-11)7-5-12/h4,6,8H,3,5,7,12H2,1-2H3 |
| InChIKey | LVPPWTQHCRIEEX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |