C15H25N5O2 — CID 169237376
ethane;ethyl 1-amino-4-[1-(2-aminoethyl)pyrazol-3-yl]-3-methylpyrrole-2-carboxylate (PubChem CID 169237376) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is ethane;ethyl 1-amino-4-[1-(2-aminoethyl)pyrazol-3-yl]-3-methylpyrrole-2-carboxylate.
| Compound Name | ethane;ethyl 1-amino-4-[1-(2-aminoethyl)pyrazol-3-yl]-3-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 169237376 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | ethane;ethyl 1-amino-4-[1-(2-aminoethyl)pyrazol-3-yl]-3-methylpyrrole-2-carboxylate |
| SMILES | CC.CCOC(=O)c1c(C)c(-c2ccn(CCN)n2)cn1N |
| InChI | InChI=1S/C13H19N5O2.C2H6/c1-3-20-13(19)12-9(2)10(8-18(12)15)11-4-6-17(16-11)7-5-14;1-2/h4,6,8H,3,5,7,14-15H2,1-2H3;1-2H3 |
| InChIKey | YNKNWKXOKDXGGZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |