C14H20ClN3O2 — CID 126964545
4-[[(1-propylpyrazol-3-yl)methylamino]methyl]benzene-1,3-diol;hydrochloride (PubChem CID 126964545) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-[[(1-propylpyrazol-3-yl)methylamino]methyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[[(1-propylpyrazol-3-yl)methylamino]methyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 126964545 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-[[(1-propylpyrazol-3-yl)methylamino]methyl]benzene-1,3-diol;hydrochloride |
| SMILES | CCCn1ccc(CNCc2ccc(O)cc2O)n1.Cl |
| InChI | InChI=1S/C14H19N3O2.ClH/c1-2-6-17-7-5-12(16-17)10-15-9-11-3-4-13(18)8-14(11)19;/h3-5,7-8,15,18-19H,2,6,9-10H2,1H3;1H |
| InChIKey | UKKFKZLXWSRFFU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|