C17H35N — CID 144585171
(2R,6R)-6-(4-methylcyclohexyl)-N-propan-2-ylheptan-2-amine (PubChem CID 144585171) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is (2R,6R)-6-(4-methylcyclohexyl)-N-propan-2-ylheptan-2-amine.
| Compound Name | (2R,6R)-6-(4-methylcyclohexyl)-N-propan-2-ylheptan-2-amine |
|---|---|
| PubChem CID | 144585171 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | (2R,6R)-6-(4-methylcyclohexyl)-N-propan-2-ylheptan-2-amine |
| SMILES | CC1CCC([C@H](C)CCC[C@@H](C)NC(C)C)CC1 |
| InChI | InChI=1S/C17H35N/c1-13(2)18-16(5)8-6-7-15(4)17-11-9-14(3)10-12-17/h13-18H,6-12H2,1-5H3/t14?,15-,16-,17?/m1/s1 |
| InChIKey | YRMGIQNVHXQIJZ-JCCCHCCOSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |