C18H24N2O — CID 144587299
N,4-dimethylpyridine-2-carboxamide;1-methyl-4-propylbenzene (PubChem CID 144587299) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N,4-dimethylpyridine-2-carboxamide;1-methyl-4-propylbenzene.
| Compound Name | N,4-dimethylpyridine-2-carboxamide;1-methyl-4-propylbenzene |
|---|---|
| PubChem CID | 144587299 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N,4-dimethylpyridine-2-carboxamide;1-methyl-4-propylbenzene |
| SMILES | CCCc1ccc(C)cc1.CNC(=O)c1cc(C)ccn1 |
| InChI | InChI=1S/C10H14.C8H10N2O/c1-3-4-10-7-5-9(2)6-8-10;1-6-3-4-10-7(5-6)8(11)9-2/h5-8H,3-4H2,1-2H3;3-5H,1-2H3,(H,9,11) |
| InChIKey | XYJRBMJCEAATLN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |