C8H11N3O2 — CID 142264154
4-(aminooxymethyl)-N-methylpyridine-2-carboxamide (PubChem CID 142264154) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-(aminooxymethyl)-N-methylpyridine-2-carboxamide.
| Compound Name | 4-(aminooxymethyl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 142264154 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-(aminooxymethyl)-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(CON)ccn1 |
| InChI | InChI=1S/C8H11N3O2/c1-10-8(12)7-4-6(5-13-9)2-3-11-7/h2-4H,5,9H2,1H3,(H,10,12) |
| InChIKey | XOIJFFPKFXGGEL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|