C44H36N2S — CID 144587937
N-[4-(7-tert-butyl-4-phenylthieno[3,2-b]indol-2-yl)phenyl]-N,4-diphenylaniline (PubChem CID 144587937) has the molecular formula C44H36N2S and a molecular weight of 624.85 g/mol. Its IUPAC name is N-[4-(7-tert-butyl-4-phenylthieno[3,2-b]indol-2-yl)phenyl]-N,4-diphenylaniline.
| Compound Name | N-[4-(7-tert-butyl-4-phenylthieno[3,2-b]indol-2-yl)phenyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 144587937 |
| Molecular Formula | C44H36N2S |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | N-[4-(7-tert-butyl-4-phenylthieno[3,2-b]indol-2-yl)phenyl]-N,4-diphenylaniline |
| SMILES | CC(C)(C)c1ccc2c(c1)c1sc(-c3ccc(N(c4ccccc4)c4ccc(-c5ccccc5)cc4)cc3)cc1n2-c1ccccc1 |
| InChI | InChI=1S/C44H36N2S/c1-44(2,3)34-23-28-40-39(29-34)43-41(46(40)36-17-11-6-12-18-36)30-42(47-43)33-21-26-38(27-22-33)45(35-15-9-5-10-16-35)37-24-19-32(20-25-37)31-13-7-4-8-14-31/h4-30H,1-3H3 |
| InChIKey | PXXRJOCMJOQBHF-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |