C60H83FO2S6 — CID 144588017
2-tert-butyl-6-(4-tert-butyl-3-fluorothieno[2,3-c]thiophen-6-yl)-4,8-bis[5-(2-ethylhexyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole;decyl acetate (PubChem CID 144588017) has the molecular formula C60H83FO2S6 and a molecular weight of 1047.72 g/mol. Its IUPAC name is 2-tert-butyl-6-(4-tert-butyl-3-fluorothieno[2,3-c]thiophen-6-yl)-4,8-bis[5-(2-ethylhexyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole;decyl acetate.
| Compound Name | 2-tert-butyl-6-(4-tert-butyl-3-fluorothieno[2,3-c]thiophen-6-yl)-4,8-bis[5-(2-ethylhexyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole;decyl acetate |
|---|---|
| PubChem CID | 144588017 |
| Molecular Formula | C60H83FO2S6 |
| Molecular Weight | 1047.72 g/mol |
| Exact Mass | 1046.47 |
| IUPAC Name | 2-tert-butyl-6-(4-tert-butyl-3-fluorothieno[2,3-c]thiophen-6-yl)-4,8-bis[5-(2-ethylhexyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole;decyl acetate |
| SMILES | CCCCC(CC)Cc1ccc(-c2c3cc(C(C)(C)C)sc3c(-c3ccc(CC(CC)CCCC)s3)c3cc(-c4sc(C(C)(C)C)c5c(F)csc45)sc23)s1.CCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C48H59FS6.C12H24O2/c1-11-15-17-28(13-3)23-30-19-21-35(51-30)39-32-25-37(44-45-41(34(49)27-50-45)46(55-44)48(8,9)10)53-42(32)40(33-26-38(47(5,6)7)54-43(33)39)36-22-20-31(52-36)24-29(14-4)18-16-12-2;1-3-4-5-6-7-8-9-10-11-14-12(2)13/h19-22,25-29H,11-18,23-24H2,1-10H3;3-11H2,1-2H3 |
| InChIKey | QTOFRPFGQLFMGM-UHFFFAOYSA-N |
| XLogP | 22.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.72 |
| LogP ≤ 5 | 22.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|