About 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid
2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid (PubChem CID 14458984) has the molecular formula C17H10BrCl2FN2O4
and a molecular weight of 476.09 g/mol. Its IUPAC name is 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid |
| PubChem CID | 14458984 |
| Molecular Formula | C17H10BrCl2FN2O4 |
| Molecular Weight | 476.09 g/mol |
| Exact Mass | 473.92 |
| IUPAC Name | 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(=O)n(Cc2ccc(Br)cc2F)c(=O)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C17H10BrCl2FN2O4/c18-9-2-1-8(12(21)3-9)6-23-16(26)15-11(20)4-10(19)5-13(15)22(17(23)27)7-14(24)25/h1-5H,6-7H2,(H,24,25) |
| InChIKey | QWCDEEFYNYRJCB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.09 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid?
The IUPAC name of 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid (CID 14458984) is 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid.
What is the SMILES notation for 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid?
The canonical SMILES for 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid is O=C(O)Cn1c(=O)n(Cc2ccc(Br)cc2F)c(=O)c2c(Cl)cc(Cl)cc21.
What is the InChIKey of 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid?
The InChIKey is QWCDEEFYNYRJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10BrCl2FN2O4/c18-9-2-1-8(12(21)3-9)6-23-16(26)15-11(20)4-10(19)5-13(15)22(17(23)27)7-14(24)25/h1-5H,6-7H2,(H,24,25).
What are the key properties of 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid?
2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid has a molecular weight of 476.09 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(4-bromo-2-fluorophenyl)methyl]-5,7-dichloro-2,4-dioxoquinazolin-1-yl]acetic acid is sourced from PubChem (CID 14458984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).