C19H14BrF2NO3 — CID 90828095
1-[(4-bromo-2-fluorophenyl)methyl]-2-ethyl-5-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 90828095) has the molecular formula C19H14BrF2NO3 and a molecular weight of 422.23 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-2-ethyl-5-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-2-ethyl-5-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 90828095 |
| Molecular Formula | C19H14BrF2NO3 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-2-ethyl-5-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c(=O)c2c(F)cccc2n1Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C19H14BrF2NO3/c1-2-14-17(19(25)26)18(24)16-12(21)4-3-5-15(16)23(14)9-10-6-7-11(20)8-13(10)22/h3-8H,2,9H2,1H3,(H,25,26) |
| InChIKey | IDRNCQZZXRDEFX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |