C18H16F4O7S2 — CID 144591811
1,1,2,2-tetrafluoro-5-(8-methyldibenzofuran-3-yl)sulfonyloxypentane-1-sulfonic acid (PubChem CID 144591811) has the molecular formula C18H16F4O7S2 and a molecular weight of 484.45 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-(8-methyldibenzofuran-3-yl)sulfonyloxypentane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-5-(8-methyldibenzofuran-3-yl)sulfonyloxypentane-1-sulfonic acid |
|---|---|
| PubChem CID | 144591811 |
| Molecular Formula | C18H16F4O7S2 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-(8-methyldibenzofuran-3-yl)sulfonyloxypentane-1-sulfonic acid |
| SMILES | Cc1ccc2oc3cc(S(=O)(=O)OCCCC(F)(F)C(F)(F)S(=O)(=O)O)ccc3c2c1 |
| InChI | InChI=1S/C18H16F4O7S2/c1-11-3-6-15-14(9-11)13-5-4-12(10-16(13)29-15)30(23,24)28-8-2-7-17(19,20)18(21,22)31(25,26)27/h3-6,9-10H,2,7-8H2,1H3,(H,25,26,27) |
| InChIKey | FTQXNXMMOVEHLX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|